C10H15NO2 — CID 116927561
methyl 2,2-dimethyl-3-(1H-pyrrol-3-yl)propanoate (PubChem CID 116927561) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-(1H-pyrrol-3-yl)propanoate.
| Compound Name | methyl 2,2-dimethyl-3-(1H-pyrrol-3-yl)propanoate |
|---|---|
| PubChem CID | 116927561 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | methyl 2,2-dimethyl-3-(1H-pyrrol-3-yl)propanoate |
| SMILES | COC(=O)C(C)(C)Cc1cc[nH]c1 |
| InChI | InChI=1S/C10H15NO2/c1-10(2,9(12)13-3)6-8-4-5-11-7-8/h4-5,7,11H,6H2,1-3H3 |
| InChIKey | OMGCZDKIUFXXKT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |