C18H27NO7 — CID 68618449
(2R)-2-[4-(1-ethoxy-1-methoxyethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (PubChem CID 68618449) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is (2R)-2-[4-(1-ethoxy-1-methoxyethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid.
| Compound Name | (2R)-2-[4-(1-ethoxy-1-methoxyethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 68618449 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2R)-2-[4-(1-ethoxy-1-methoxyethoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| SMILES | CCOC(C)(OC)Oc1ccc([C@@H](NC(=O)OC(C)(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C18H27NO7/c1-7-24-18(5,23-6)25-13-10-8-12(9-11-13)14(15(20)21)19-16(22)26-17(2,3)4/h8-11,14H,7H2,1-6H3,(H,19,22)(H,20,21)/t14-,18?/m1/s1 |
| InChIKey | JMCIWZCYNHXPFC-IKJXHCRLSA-N |
| XLogP | 3.07 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|