C16H22NO8P — CID 87517676
(2R)-2-[4-[dimethoxy(phosphoroso)methoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (PubChem CID 87517676) has the molecular formula C16H22NO8P and a molecular weight of 387.33 g/mol. Its IUPAC name is (2R)-2-[4-[dimethoxy(phosphoroso)methoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid.
| Compound Name | (2R)-2-[4-[dimethoxy(phosphoroso)methoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 87517676 |
| Molecular Formula | C16H22NO8P |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (2R)-2-[4-[dimethoxy(phosphoroso)methoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| SMILES | COC(OC)(Oc1ccc([C@@H](NC(=O)OC(C)(C)C)C(=O)O)cc1)P=O |
| InChI | InChI=1S/C16H22NO8P/c1-15(2,3)25-14(20)17-12(13(18)19)10-6-8-11(9-7-10)24-16(22-4,23-5)26-21/h6-9,12H,1-5H3,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | IHANMFPECZSQRD-GFCCVEGCSA-N |
| XLogP | 2.91 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|