C29H36O6 — CID 87583303
tert-butyl [4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenyl] carbonate;tert-butyl 2-methylprop-2-enoate (PubChem CID 87583303) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is tert-butyl [4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenyl] carbonate;tert-butyl 2-methylprop-2-enoate.
| Compound Name | tert-butyl [4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenyl] carbonate;tert-butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87583303 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | tert-butyl [4-[4-(4-hydroxyphenyl)buta-1,3-dienyl]phenyl] carbonate;tert-butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C.CC(C)(C)OC(=O)Oc1ccc(C=CC=Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H22O4.C8H14O2/c1-21(2,3)25-20(23)24-19-14-10-17(11-15-19)7-5-4-6-16-8-12-18(22)13-9-16;1-6(2)7(9)10-8(3,4)5/h4-15,22H,1-3H3;1H2,2-5H3 |
| InChIKey | YGTYJYJKPQUDFV-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|