C49H60O12 — CID 158198671
[3-[2-(4-hydroxyphenyl)-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate;[3-[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 158198671) has the molecular formula C49H60O12 and a molecular weight of 841.01 g/mol. Its IUPAC name is [3-[2-(4-hydroxyphenyl)-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate;[3-[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3-[2-(4-hydroxyphenyl)-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate;[3-[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158198671 |
| Molecular Formula | C49H60O12 |
| Molecular Weight | 841.01 g/mol |
| Exact Mass | 840.41 |
| IUPAC Name | [3-[2-(4-hydroxyphenyl)-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate;[3-[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(CC(OCC(=O)c4ccc(O)cc4)(C3)C1)C2.C=C(C)C(=O)OC12CC3CC(CC(OCC(=O)c4ccc(OC(=O)OC(C)(C)C)cc4)(C3)C1)C2 |
| InChI | InChI=1S/C27H34O7.C22H26O5/c1-17(2)23(29)33-27-13-18-10-19(14-27)12-26(11-18,16-27)31-15-22(28)20-6-8-21(9-7-20)32-24(30)34-25(3,4)5;1-14(2)20(25)27-22-10-15-7-16(11-22)9-21(8-15,13-22)26-12-19(24)17-3-5-18(23)6-4-17/h6-9,18-19H,1,10-16H2,2-5H3;3-6,15-16,23H,1,7-13H2,2H3 |
| InChIKey | GAQSSKREINVSMJ-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.01 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|