C37H56O8 — CID 159166772
(2-ethyl-2-adamantyl) 2,2-dimethylbutanoate;[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-oxoethyl] 2,2-dimethylbutanoate (PubChem CID 159166772) has the molecular formula C37H56O8 and a molecular weight of 628.85 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl) 2,2-dimethylbutanoate;[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-oxoethyl] 2,2-dimethylbutanoate.
| Compound Name | (2-ethyl-2-adamantyl) 2,2-dimethylbutanoate;[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-oxoethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159166772 |
| Molecular Formula | C37H56O8 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.40 |
| IUPAC Name | (2-ethyl-2-adamantyl) 2,2-dimethylbutanoate;[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-2-oxoethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(CC)C2CC3CC(C2)CC1C3.CCC(C)(C)C(=O)OCC(=O)c1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H26O6.C18H30O2/c1-7-19(5,6)16(21)23-12-15(20)13-8-10-14(11-9-13)24-17(22)25-18(2,3)4;1-5-17(3,4)16(19)20-18(6-2)14-8-12-7-13(10-14)11-15(18)9-12/h8-11H,7,12H2,1-6H3;12-15H,5-11H2,1-4H3 |
| InChIKey | KLEBNXZHRWUJSU-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|