C22H24O4 — CID 67610410
tert-butyl 2-(4-ethenylphenoxy)-4-(4-hydroxyphenyl)but-3-enoate (PubChem CID 67610410) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl 2-(4-ethenylphenoxy)-4-(4-hydroxyphenyl)but-3-enoate.
| Compound Name | tert-butyl 2-(4-ethenylphenoxy)-4-(4-hydroxyphenyl)but-3-enoate |
|---|---|
| PubChem CID | 67610410 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | tert-butyl 2-(4-ethenylphenoxy)-4-(4-hydroxyphenyl)but-3-enoate |
| SMILES | C=Cc1ccc(OC(C=Cc2ccc(O)cc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H24O4/c1-5-16-8-13-19(14-9-16)25-20(21(24)26-22(2,3)4)15-10-17-6-11-18(23)12-7-17/h5-15,20,23H,1H2,2-4H3 |
| InChIKey | WETYABLVBGTISD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |