C24H28O8S — CID 143987027
(4R)-4-hydroxy-2-[(S)-hydroxy(hydroxysulfanyl)methoxy]-3-[4-[(1Z)-1-(4-hydroxyphenyl)penta-1,4-dien-3-yl]phenoxy]-2-methylpentanoic acid (PubChem CID 143987027) has the molecular formula C24H28O8S and a molecular weight of 476.55 g/mol. Its IUPAC name is (4R)-4-hydroxy-2-[(S)-hydroxy(hydroxysulfanyl)methoxy]-3-[4-[(1Z)-1-(4-hydroxyphenyl)penta-1,4-dien-3-yl]phenoxy]-2-methylpentanoic acid.
| Compound Name | (4R)-4-hydroxy-2-[(S)-hydroxy(hydroxysulfanyl)methoxy]-3-[4-[(1Z)-1-(4-hydroxyphenyl)penta-1,4-dien-3-yl]phenoxy]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 143987027 |
| Molecular Formula | C24H28O8S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | (4R)-4-hydroxy-2-[(S)-hydroxy(hydroxysulfanyl)methoxy]-3-[4-[(1Z)-1-(4-hydroxyphenyl)penta-1,4-dien-3-yl]phenoxy]-2-methylpentanoic acid |
| SMILES | C=CC(/C=C\c1ccc(O)cc1)c1ccc(OC([C@@H](C)O)C(C)(O[C@H](O)SO)C(=O)O)cc1 |
| InChI | InChI=1S/C24H28O8S/c1-4-17(8-5-16-6-11-19(26)12-7-16)18-9-13-20(14-10-18)31-21(15(2)25)24(3,22(27)28)32-23(29)33-30/h4-15,17,21,23,25-26,29-30H,1H2,2-3H3,(H,27,28)/b8-5-/t15-,17?,21?,23+,24?/m1/s1 |
| InChIKey | DBWBVJRAOALTEX-MFWCBYJASA-N |
| XLogP | 3.85 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|