About 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol
4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol (PubChem CID 90924622) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol.
Molecular Properties
| Compound Name | 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol |
| PubChem CID | 90924622 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol |
| SMILES | C=CC(C=Cc1ccc(ON)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H17NO2/c1-2-14(15-7-9-16(19)10-8-15)6-3-13-4-11-17(20-18)12-5-13/h2-12,14,19H,1,18H2 |
| InChIKey | PVXUZJDXBSZOLX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol?
The IUPAC name of 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol (CID 90924622) is 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol.
What is the SMILES notation for 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol?
The canonical SMILES for 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol is C=CC(C=Cc1ccc(ON)cc1)c1ccc(O)cc1.
What is the InChIKey of 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol?
The InChIKey is PVXUZJDXBSZOLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO2/c1-2-14(15-7-9-16(19)10-8-15)6-3-13-4-11-17(20-18)12-5-13/h2-12,14,19H,1,18H2.
What are the key properties of 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol?
4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol has a molecular weight of 267.33 g/mol, XLogP of 3.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-aminooxyphenyl)penta-1,4-dien-3-yl]phenol is sourced from PubChem (CID 90924622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).