About 4-aminooxyphenol
4-aminooxyphenol (PubChem CID 67279043) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is 4-aminooxyphenol.
Molecular Properties
| Compound Name | 4-aminooxyphenol |
| PubChem CID | 67279043 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 4-aminooxyphenol |
| SMILES | NOc1ccc(O)cc1 |
| InChI | InChI=1S/C6H7NO2/c7-9-6-3-1-5(8)2-4-6/h1-4,8H,7H2 |
| InChIKey | QCHWZLKFYOWKAE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminooxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminooxyphenol?
The IUPAC name of 4-aminooxyphenol (CID 67279043) is 4-aminooxyphenol.
What is the SMILES notation for 4-aminooxyphenol?
The canonical SMILES for 4-aminooxyphenol is NOc1ccc(O)cc1.
What is the InChIKey of 4-aminooxyphenol?
The InChIKey is QCHWZLKFYOWKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c7-9-6-3-1-5(8)2-4-6/h1-4,8H,7H2.
What are the key properties of 4-aminooxyphenol?
4-aminooxyphenol has a molecular weight of 125.13 g/mol, XLogP of 0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxyphenol is sourced from PubChem (CID 67279043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).