About CID 162428523
CID 162428523 (PubChem CID 162428523) has the molecular formula C6H5AlO2
and a molecular weight of 136.09 g/mol.
Molecular Properties
| Compound Name | CID 162428523 |
| PubChem CID | 162428523 |
| Molecular Formula | C6H5AlO2 |
| Molecular Weight | 136.09 g/mol |
| Exact Mass | 136.01 |
| IUPAC Name | — |
| SMILES | Oc1ccc(O[Al])cc1 |
| InChI | InChI=1S/C6H6O2.Al/c7-5-1-2-6(8)4-3-5;/h1-4,7-8H;/q;+1/p-1 |
| InChIKey | DRTIKCBWPBYYCD-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.09 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 162428523 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162428523?
The IUPAC name of CID 162428523 (CID 162428523) is not available.
What is the SMILES notation for CID 162428523?
The canonical SMILES for CID 162428523 is Oc1ccc(O[Al])cc1.
What is the InChIKey of CID 162428523?
The InChIKey is DRTIKCBWPBYYCD-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O2.Al/c7-5-1-2-6(8)4-3-5;/h1-4,7-8H;/q;+1/p-1.
What are the key properties of CID 162428523?
CID 162428523 has a molecular weight of 136.09 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162428523 is sourced from PubChem (CID 162428523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).