C24H34O4 — CID 88695550
methyl 2-methylprop-2-enoate;octan-3-yl 2-methylidene-4-phenylbut-3-enoate (PubChem CID 88695550) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;octan-3-yl 2-methylidene-4-phenylbut-3-enoate.
| Compound Name | methyl 2-methylprop-2-enoate;octan-3-yl 2-methylidene-4-phenylbut-3-enoate |
|---|---|
| PubChem CID | 88695550 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | methyl 2-methylprop-2-enoate;octan-3-yl 2-methylidene-4-phenylbut-3-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C=Cc1ccccc1)C(=O)OC(CC)CCCCC |
| InChI | InChI=1S/C19H26O2.C5H8O2/c1-4-6-8-13-18(5-2)21-19(20)16(3)14-15-17-11-9-7-10-12-17;1-4(2)5(6)7-3/h7,9-12,14-15,18H,3-6,8,13H2,1-2H3;1H2,2-3H3 |
| InChIKey | YGRQWXGSBSEHOO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|