C18H26O4 — CID 22743729
hexane-1,1-diol;[(E)-2-phenylethenyl] 2-methylprop-2-enoate (PubChem CID 22743729) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is hexane-1,1-diol;[(E)-2-phenylethenyl] 2-methylprop-2-enoate.
| Compound Name | hexane-1,1-diol;[(E)-2-phenylethenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22743729 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | hexane-1,1-diol;[(E)-2-phenylethenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O/C=C/c1ccccc1.CCCCCC(O)O |
| InChI | InChI=1S/C12H12O2.C6H14O2/c1-10(2)12(13)14-9-8-11-6-4-3-5-7-11;1-2-3-4-5-6(7)8/h3-9H,1H2,2H3;6-8H,2-5H2,1H3/b9-8+; |
| InChIKey | IQFYFLMFWOXKJB-HRNDJLQDSA-N |
| XLogP | 3.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|