C29H38O8 — CID 87773921
butyl 2-methylidene-4-phenylbut-3-enoate;4-ethoxycarbonyl-2-methylpenta-2,4-dienoic acid;methyl 2-methylprop-2-enoate (PubChem CID 87773921) has the molecular formula C29H38O8 and a molecular weight of 514.62 g/mol. Its IUPAC name is butyl 2-methylidene-4-phenylbut-3-enoate;4-ethoxycarbonyl-2-methylpenta-2,4-dienoic acid;methyl 2-methylprop-2-enoate.
| Compound Name | butyl 2-methylidene-4-phenylbut-3-enoate;4-ethoxycarbonyl-2-methylpenta-2,4-dienoic acid;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87773921 |
| Molecular Formula | C29H38O8 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | butyl 2-methylidene-4-phenylbut-3-enoate;4-ethoxycarbonyl-2-methylpenta-2,4-dienoic acid;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C=C(C)C(=O)O)C(=O)OCC.C=C(C=Cc1ccccc1)C(=O)OCCCC |
| InChI | InChI=1S/C15H18O2.C9H12O4.C5H8O2/c1-3-4-12-17-15(16)13(2)10-11-14-8-6-5-7-9-14;1-4-13-9(12)7(3)5-6(2)8(10)11;1-4(2)5(6)7-3/h5-11H,2-4,12H2,1H3;5H,3-4H2,1-2H3,(H,10,11);1H2,2-3H3 |
| InChIKey | JPNAADBMKXNFDP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|