C22H28O6 — CID 87703422
4-butoxycarbonyl-2-methylpenta-2,4-dienoic acid;prop-2-enoic acid;styrene (PubChem CID 87703422) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 4-butoxycarbonyl-2-methylpenta-2,4-dienoic acid;prop-2-enoic acid;styrene.
| Compound Name | 4-butoxycarbonyl-2-methylpenta-2,4-dienoic acid;prop-2-enoic acid;styrene |
|---|---|
| PubChem CID | 87703422 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-butoxycarbonyl-2-methylpenta-2,4-dienoic acid;prop-2-enoic acid;styrene |
| SMILES | C=C(C=C(C)C(=O)O)C(=O)OCCCC.C=CC(=O)O.C=Cc1ccccc1 |
| InChI | InChI=1S/C11H16O4.C8H8.C3H4O2/c1-4-5-6-15-11(14)9(3)7-8(2)10(12)13;1-2-8-6-4-3-5-7-8;1-2-3(4)5/h7H,3-6H2,1-2H3,(H,12,13);2-7H,1H2;2H,1H2,(H,4,5) |
| InChIKey | FCKNKRAMPGBIQF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|