C28H38O6 — CID 175366082
2,9-dimethyl-3-(2-methylidene-4-phenylbut-3-enoyl)oxydec-2-enoic acid;methyl 2-methylprop-2-enoate (PubChem CID 175366082) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2,9-dimethyl-3-(2-methylidene-4-phenylbut-3-enoyl)oxydec-2-enoic acid;methyl 2-methylprop-2-enoate.
| Compound Name | 2,9-dimethyl-3-(2-methylidene-4-phenylbut-3-enoyl)oxydec-2-enoic acid;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175366082 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 2,9-dimethyl-3-(2-methylidene-4-phenylbut-3-enoyl)oxydec-2-enoic acid;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C=Cc1ccccc1)C(=O)OC(CCCCCC(C)C)=C(C)C(=O)O |
| InChI | InChI=1S/C23H30O4.C5H8O2/c1-17(2)11-7-5-10-14-21(19(4)22(24)25)27-23(26)18(3)15-16-20-12-8-6-9-13-20;1-4(2)5(6)7-3/h6,8-9,12-13,15-17H,3,5,7,10-11,14H2,1-2,4H3,(H,24,25);1H2,2-3H3 |
| InChIKey | BFMHJWPNRBXNON-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|