C18H24O8S — CID 86759870
2-hydroxyethyl 2-methylprop-2-enoate;2-(4-methylphenyl)sulfonyloxyethyl prop-2-enoate (PubChem CID 86759870) has the molecular formula C18H24O8S and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;2-(4-methylphenyl)sulfonyloxyethyl prop-2-enoate.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-(4-methylphenyl)sulfonyloxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 86759870 |
| Molecular Formula | C18H24O8S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-(4-methylphenyl)sulfonyloxyethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=CC(=O)OCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H14O5S.C6H10O3/c1-3-12(13)16-8-9-17-18(14,15)11-6-4-10(2)5-7-11;1-5(2)6(8)9-4-3-7/h3-7H,1,8-9H2,2H3;7H,1,3-4H2,2H3 |
| InChIKey | OVHDLADPJHAZDL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|