About 2-phenylethenesulfonic acid;pyridine
2-phenylethenesulfonic acid;pyridine (PubChem CID 173034936) has the molecular formula C13H13NO3S
and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-phenylethenesulfonic acid;pyridine.
Molecular Properties
| Compound Name | 2-phenylethenesulfonic acid;pyridine |
| PubChem CID | 173034936 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-phenylethenesulfonic acid;pyridine |
| SMILES | O=S(=O)(O)C=Cc1ccccc1.c1ccncc1 |
| InChI | InChI=1S/C8H8O3S.C5H5N/c9-12(10,11)7-6-8-4-2-1-3-5-8;1-2-4-6-5-3-1/h1-7H,(H,9,10,11);1-5H |
| InChIKey | RUYABNZYCIOHKQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethenesulfonic acid;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethenesulfonic acid;pyridine?
The IUPAC name of 2-phenylethenesulfonic acid;pyridine (CID 173034936) is 2-phenylethenesulfonic acid;pyridine.
What is the SMILES notation for 2-phenylethenesulfonic acid;pyridine?
The canonical SMILES for 2-phenylethenesulfonic acid;pyridine is O=S(=O)(O)C=Cc1ccccc1.c1ccncc1.
What is the InChIKey of 2-phenylethenesulfonic acid;pyridine?
The InChIKey is RUYABNZYCIOHKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S.C5H5N/c9-12(10,11)7-6-8-4-2-1-3-5-8;1-2-4-6-5-3-1/h1-7H,(H,9,10,11);1-5H.
What are the key properties of 2-phenylethenesulfonic acid;pyridine?
2-phenylethenesulfonic acid;pyridine has a molecular weight of 263.32 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenesulfonic acid;pyridine is sourced from PubChem (CID 173034936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).