About 2-ethenylpyridine;2-phenylethenesulfonic acid
2-ethenylpyridine;2-phenylethenesulfonic acid (PubChem CID 88722678) has the molecular formula C15H15NO3S
and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-ethenylpyridine;2-phenylethenesulfonic acid.
Molecular Properties
| Compound Name | 2-ethenylpyridine;2-phenylethenesulfonic acid |
| PubChem CID | 88722678 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-ethenylpyridine;2-phenylethenesulfonic acid |
| SMILES | C=Cc1ccccn1.O=S(=O)(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8O3S.C7H7N/c9-12(10,11)7-6-8-4-2-1-3-5-8;1-2-7-5-3-4-6-8-7/h1-7H,(H,9,10,11);2-6H,1H2 |
| InChIKey | FEEBHTVOFPORAF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylpyridine;2-phenylethenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylpyridine;2-phenylethenesulfonic acid?
The IUPAC name of 2-ethenylpyridine;2-phenylethenesulfonic acid (CID 88722678) is 2-ethenylpyridine;2-phenylethenesulfonic acid.
What is the SMILES notation for 2-ethenylpyridine;2-phenylethenesulfonic acid?
The canonical SMILES for 2-ethenylpyridine;2-phenylethenesulfonic acid is C=Cc1ccccn1.O=S(=O)(O)C=Cc1ccccc1.
What is the InChIKey of 2-ethenylpyridine;2-phenylethenesulfonic acid?
The InChIKey is FEEBHTVOFPORAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S.C7H7N/c9-12(10,11)7-6-8-4-2-1-3-5-8;1-2-7-5-3-4-6-8-7/h1-7H,(H,9,10,11);2-6H,1H2.
What are the key properties of 2-ethenylpyridine;2-phenylethenesulfonic acid?
2-ethenylpyridine;2-phenylethenesulfonic acid has a molecular weight of 289.36 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylpyridine;2-phenylethenesulfonic acid is sourced from PubChem (CID 88722678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).