C23H38F6N2O4S2 — CID 171929637
N,N-dimethyl-13-phenyltridecan-1-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 171929637) has the molecular formula C23H38F6N2O4S2 and a molecular weight of 584.69 g/mol. Its IUPAC name is N,N-dimethyl-13-phenyltridecan-1-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | N,N-dimethyl-13-phenyltridecan-1-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 171929637 |
| Molecular Formula | C23H38F6N2O4S2 |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | N,N-dimethyl-13-phenyltridecan-1-amine;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CN(C)CCCCCCCCCCCCCc1ccccc1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H37N.C2HF6NO4S2/c1-22(2)20-16-11-9-7-5-3-4-6-8-10-13-17-21-18-14-12-15-19-21;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h12,14-15,18-19H,3-11,13,16-17,20H2,1-2H3;9H |
| InChIKey | FMNQKLTVTRHSTE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|