C24H37N3 — CID 135143739
(4R,8S)-8-benzyl-4-N-(2-phenylethyl)nonane-1,4,9-triamine (PubChem CID 135143739) has the molecular formula C24H37N3 and a molecular weight of 367.58 g/mol. Its IUPAC name is (4R,8S)-8-benzyl-4-N-(2-phenylethyl)nonane-1,4,9-triamine.
| Compound Name | (4R,8S)-8-benzyl-4-N-(2-phenylethyl)nonane-1,4,9-triamine |
|---|---|
| PubChem CID | 135143739 |
| Molecular Formula | C24H37N3 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.30 |
| IUPAC Name | (4R,8S)-8-benzyl-4-N-(2-phenylethyl)nonane-1,4,9-triamine |
| SMILES | NCCC[C@@H](CCCC(CN)Cc1ccccc1)NCCc1ccccc1 |
| InChI | InChI=1S/C24H37N3/c25-17-8-15-24(27-18-16-21-9-3-1-4-10-21)14-7-13-23(20-26)19-22-11-5-2-6-12-22/h1-6,9-12,23-24,27H,7-8,13-20,25-26H2/t23?,24-/m1/s1 |
| InChIKey | JKZOVBYDVZSJFU-XMMISQBUSA-N |
| XLogP | 3.91 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |