C14H24N2 — CID 71061994
N'-(6-phenylhexan-3-yl)ethane-1,2-diamine (PubChem CID 71061994) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N'-(6-phenylhexan-3-yl)ethane-1,2-diamine.
| Compound Name | N'-(6-phenylhexan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 71061994 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N'-(6-phenylhexan-3-yl)ethane-1,2-diamine |
| SMILES | CCC(CCCc1ccccc1)NCCN |
| InChI | InChI=1S/C14H24N2/c1-2-14(16-12-11-15)10-6-9-13-7-4-3-5-8-13/h3-5,7-8,14,16H,2,6,9-12,15H2,1H3 |
| InChIKey | WNKXYOKOCKZWED-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |