C21H30N2 — CID 70494547
N-methyl-2-phenyl-N'-(3-phenylpropyl)pentane-1,5-diamine (PubChem CID 70494547) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is N-methyl-2-phenyl-N'-(3-phenylpropyl)pentane-1,5-diamine.
| Compound Name | N-methyl-2-phenyl-N'-(3-phenylpropyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 70494547 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | N-methyl-2-phenyl-N'-(3-phenylpropyl)pentane-1,5-diamine |
| SMILES | CNCC(CCCNCCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H30N2/c1-22-18-21(20-13-6-3-7-14-20)15-9-17-23-16-8-12-19-10-4-2-5-11-19/h2-7,10-11,13-14,21-23H,8-9,12,15-18H2,1H3 |
| InChIKey | RJHDBWRKSRSQGS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|