C18H23N — CID 81024071
N-ethyl-2,4-diphenylbutan-1-amine (PubChem CID 81024071) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is N-ethyl-2,4-diphenylbutan-1-amine.
| Compound Name | N-ethyl-2,4-diphenylbutan-1-amine |
|---|---|
| PubChem CID | 81024071 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-ethyl-2,4-diphenylbutan-1-amine |
| SMILES | CCNCC(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23N/c1-2-19-15-18(17-11-7-4-8-12-17)14-13-16-9-5-3-6-10-16/h3-12,18-19H,2,13-15H2,1H3 |
| InChIKey | PTAZJRXMMHTOGI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |