C17H28N2O — CID 82848318
5-amino-N-(2,2-dimethyl-1-phenylpropyl)hexanamide (PubChem CID 82848318) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 5-amino-N-(2,2-dimethyl-1-phenylpropyl)hexanamide.
| Compound Name | 5-amino-N-(2,2-dimethyl-1-phenylpropyl)hexanamide |
|---|---|
| PubChem CID | 82848318 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 5-amino-N-(2,2-dimethyl-1-phenylpropyl)hexanamide |
| SMILES | CC(N)CCCC(=O)NC(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H28N2O/c1-13(18)9-8-12-15(20)19-16(17(2,3)4)14-10-6-5-7-11-14/h5-7,10-11,13,16H,8-9,12,18H2,1-4H3,(H,19,20) |
| InChIKey | UWMUGIMNIMSVMK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |