C15H21F3N2O — CID 115750835
N-tert-butyl-3-[(2,2,2-trifluoro-1-phenylethyl)amino]propanamide (PubChem CID 115750835) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is N-tert-butyl-3-[(2,2,2-trifluoro-1-phenylethyl)amino]propanamide.
| Compound Name | N-tert-butyl-3-[(2,2,2-trifluoro-1-phenylethyl)amino]propanamide |
|---|---|
| PubChem CID | 115750835 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-tert-butyl-3-[(2,2,2-trifluoro-1-phenylethyl)amino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCNC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O/c1-14(2,3)20-12(21)9-10-19-13(15(16,17)18)11-7-5-4-6-8-11/h4-8,13,19H,9-10H2,1-3H3,(H,20,21) |
| InChIKey | RTFQUFYUYHTZNM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |