C16H21F3N2O3 — CID 56794608
methyl 5-[[2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetyl]amino]pentanoate (PubChem CID 56794608) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is methyl 5-[[2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetyl]amino]pentanoate.
| Compound Name | methyl 5-[[2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 56794608 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methyl 5-[[2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetyl]amino]pentanoate |
| SMILES | COC(=O)CCCCNC(=O)CNC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O3/c1-24-14(23)9-5-6-10-20-13(22)11-21-15(16(17,18)19)12-7-3-2-4-8-12/h2-4,7-8,15,21H,5-6,9-11H2,1H3,(H,20,22) |
| InChIKey | LPUAJFKVCSEXCY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|