methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate

C21H23NO5 — CID 9229280

IUPACmethyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate
SMILESCOC(=O)CCCNC(=O)COC(=O)C(c1ccccc1)c1ccccc1
InChIInChI=1S/C21H23NO5/c1-26-19(24)13-8-14-22-18(23)15-27-21(25)20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,20H,8,13-15H2,1H3,(H,22,23)
InChIKeyRXFAPCWJRXGBPU-UHFFFAOYSA-N
MW369.42 g/mol
LogP2.43
Rot. Bonds9

About methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate

methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate (PubChem CID 9229280) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate.

Molecular Properties

Compound Namemethyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate
PubChem CID9229280
Molecular FormulaC21H23NO5
Molecular Weight369.42 g/mol
Exact Mass369.16
IUPAC Namemethyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate
SMILESCOC(=O)CCCNC(=O)COC(=O)C(c1ccccc1)c1ccccc1
InChIInChI=1S/C21H23NO5/c1-26-19(24)13-8-14-22-18(23)15-27-21(25)20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,20H,8,13-15H2,1H3,(H,22,23)
InChIKeyRXFAPCWJRXGBPU-UHFFFAOYSA-N
XLogP2.43
TPSA81.70 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500369.42
LogP ≤ 52.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate?
The IUPAC name of methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate (CID 9229280) is methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate.
What is the SMILES notation for methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate?
The canonical SMILES for methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate is COC(=O)CCCNC(=O)COC(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate?
The InChIKey is RXFAPCWJRXGBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO5/c1-26-19(24)13-8-14-22-18(23)15-27-21(25)20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,20H,8,13-15H2,1H3,(H,22,23).
What are the key properties of methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate?
methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate has a molecular weight of 369.42 g/mol, XLogP of 2.43, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(2,2-diphenylacetyl)oxyacetyl]amino]butanoate is sourced from PubChem (CID 9229280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).