C21H26N2O3 — CID 8641186
methyl 4-[[2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetyl]amino]butanoate (PubChem CID 8641186) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is methyl 4-[[2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 8641186 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | methyl 4-[[2-[[(S)-(4-methylphenyl)-phenylmethyl]amino]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN[C@@H](c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-16-10-12-18(13-11-16)21(17-7-4-3-5-8-17)23-15-19(24)22-14-6-9-20(25)26-2/h3-5,7-8,10-13,21,23H,6,9,14-15H2,1-2H3,(H,22,24)/t21-/m0/s1 |
| InChIKey | QWWIPBSEQLMFOI-NRFANRHFSA-N |
| XLogP | 2.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|