C22H29NO2 — CID 56697030
ethyl 6-[[(4-methylphenyl)-phenylmethyl]amino]hexanoate (PubChem CID 56697030) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is ethyl 6-[[(4-methylphenyl)-phenylmethyl]amino]hexanoate.
| Compound Name | ethyl 6-[[(4-methylphenyl)-phenylmethyl]amino]hexanoate |
|---|---|
| PubChem CID | 56697030 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | ethyl 6-[[(4-methylphenyl)-phenylmethyl]amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNC(c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H29NO2/c1-3-25-21(24)12-8-5-9-17-23-22(19-10-6-4-7-11-19)20-15-13-18(2)14-16-20/h4,6-7,10-11,13-16,22-23H,3,5,8-9,12,17H2,1-2H3 |
| InChIKey | PSPYLKNXEBXPCN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|