C15H23BrN2O — CID 115605352
3-[1-(3-bromophenyl)ethylamino]-N-tert-butylpropanamide (PubChem CID 115605352) has the molecular formula C15H23BrN2O and a molecular weight of 327.27 g/mol. Its IUPAC name is 3-[1-(3-bromophenyl)ethylamino]-N-tert-butylpropanamide.
| Compound Name | 3-[1-(3-bromophenyl)ethylamino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 115605352 |
| Molecular Formula | C15H23BrN2O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-[1-(3-bromophenyl)ethylamino]-N-tert-butylpropanamide |
| SMILES | CC(NCCC(=O)NC(C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H23BrN2O/c1-11(12-6-5-7-13(16)10-12)17-9-8-14(19)18-15(2,3)4/h5-7,10-11,17H,8-9H2,1-4H3,(H,18,19) |
| InChIKey | JFFHJPCANQXSMV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |