C13H18BrNO3 — CID 113436572
methyl 3-[[(1R)-1-(3-bromophenyl)ethyl]amino]-2-hydroxy-2-methylpropanoate (PubChem CID 113436572) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is methyl 3-[[(1R)-1-(3-bromophenyl)ethyl]amino]-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-[[(1R)-1-(3-bromophenyl)ethyl]amino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 113436572 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | methyl 3-[[(1R)-1-(3-bromophenyl)ethyl]amino]-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CN[C@H](C)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H18BrNO3/c1-9(10-5-4-6-11(14)7-10)15-8-13(2,17)12(16)18-3/h4-7,9,15,17H,8H2,1-3H3/t9-,13?/m1/s1 |
| InChIKey | DWUVXAKCJLTNJU-CGCSKFHYSA-N |
| XLogP | 2.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |