C18H24N2O — CID 134905502
(2R)-2-amino-1,1-diphenyl-3-(propan-2-ylamino)propan-1-ol (PubChem CID 134905502) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R)-2-amino-1,1-diphenyl-3-(propan-2-ylamino)propan-1-ol.
| Compound Name | (2R)-2-amino-1,1-diphenyl-3-(propan-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 134905502 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (2R)-2-amino-1,1-diphenyl-3-(propan-2-ylamino)propan-1-ol |
| SMILES | CC(C)NC[C@@H](N)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O/c1-14(2)20-13-17(19)18(21,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17,20-21H,13,19H2,1-2H3/t17-/m1/s1 |
| InChIKey | FHPYKULOSPUHQL-QGZVFWFLSA-N |
| XLogP | 2.25 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |