C27H42N2O — CID 102174113
(2S)-2-amino-3-(dihexylamino)-1,1-diphenylpropan-1-ol (PubChem CID 102174113) has the molecular formula C27H42N2O and a molecular weight of 410.65 g/mol. Its IUPAC name is (2S)-2-amino-3-(dihexylamino)-1,1-diphenylpropan-1-ol.
| Compound Name | (2S)-2-amino-3-(dihexylamino)-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 102174113 |
| Molecular Formula | C27H42N2O |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | (2S)-2-amino-3-(dihexylamino)-1,1-diphenylpropan-1-ol |
| SMILES | CCCCCCN(CCCCCC)C[C@H](N)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H42N2O/c1-3-5-7-15-21-29(22-16-8-6-4-2)23-26(28)27(30,24-17-11-9-12-18-24)25-19-13-10-14-20-25/h9-14,17-20,26,30H,3-8,15-16,21-23,28H2,1-2H3/t26-/m0/s1 |
| InChIKey | VOQWVODXINTGHW-SANMLTNESA-N |
| XLogP | 5.71 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|