C18H15NO2 — CID 22550393
3-phenyl-4-(1-phenylethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 22550393) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-phenyl-4-(1-phenylethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-phenyl-4-(1-phenylethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 22550393 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-phenyl-4-(1-phenylethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CC(Nc1c(-c2ccccc2)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C18H15NO2/c1-12(13-8-4-2-5-9-13)19-16-15(17(20)18(16)21)14-10-6-3-7-11-14/h2-12,19H,1H3 |
| InChIKey | OTTLBQDRDLFJTR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|