C12H11NO2 — CID 154184551
3-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 154184551) has the molecular formula C12H11NO2 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 154184551 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-[[(1R)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](Nc1cc(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C12H11NO2/c1-8(9-5-3-2-4-6-9)13-10-7-11(14)12(10)15/h2-8,13H,1H3/t8-/m1/s1 |
| InChIKey | LOAGFRXBGALEQR-MRVPVSSYSA-N |
| XLogP | 1.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|