C21H29N3O2 — CID 25207349
3-[[(1R)-1-phenylethyl]amino]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]cyclobut-3-ene-1,2-dione (PubChem CID 25207349) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-[[(1R)-1-phenylethyl]amino]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1R)-1-phenylethyl]amino]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 25207349 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 3-[[(1R)-1-phenylethyl]amino]-4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](Nc1c(NC2CC(C)(C)NC(C)(C)C2)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C21H29N3O2/c1-13(14-9-7-6-8-10-14)22-16-17(19(26)18(16)25)23-15-11-20(2,3)24-21(4,5)12-15/h6-10,13,15,22-24H,11-12H2,1-5H3/t13-/m1/s1 |
| InChIKey | QCWPYDARBIQGPD-CYBMUJFWSA-N |
| XLogP | 3.18 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|