C19H30N2O — CID 2924317
2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide (PubChem CID 2924317) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide.
| Compound Name | 2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 2924317 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide |
| SMILES | CCC(C(=O)NC1CC(C)(C)NC(C)(C)C1)c1ccccc1 |
| InChI | InChI=1S/C19H30N2O/c1-6-16(14-10-8-7-9-11-14)17(22)20-15-12-18(2,3)21-19(4,5)13-15/h7-11,15-16,21H,6,12-13H2,1-5H3,(H,20,22) |
| InChIKey | COCZPHUFQFMKDL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |