C19H22N8O2 — CID 119878694
N-[2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119878694) has the molecular formula C19H22N8O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119878694 |
| Molecular Formula | C19H22N8O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(NC(C(=O)Nc1ccn[nH]1)c1ccccc1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C19H22N8O2/c28-18(15-12-27(26-24-15)14-6-9-20-10-7-14)23-17(13-4-2-1-3-5-13)19(29)22-16-8-11-21-25-16/h1-5,8,11-12,14,17,20H,6-7,9-10H2,(H,23,28)(H2,21,22,25,29) |
| InChIKey | TUWQSWKSDWJHTL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |