C18H23ClN8O — CID 119822395
N-[1-(1-phenyltriazol-4-yl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119822395) has the molecular formula C18H23ClN8O and a molecular weight of 402.89 g/mol. Its IUPAC name is N-[1-(1-phenyltriazol-4-yl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-[1-(1-phenyltriazol-4-yl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119822395 |
| Molecular Formula | C18H23ClN8O |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[1-(1-phenyltriazol-4-yl)ethyl]-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CC(NC(=O)c1cn(C2CCNCC2)nn1)c1cn(-c2ccccc2)nn1.Cl |
| InChI | InChI=1S/C18H22N8O.ClH/c1-13(16-11-25(23-21-16)14-5-3-2-4-6-14)20-18(27)17-12-26(24-22-17)15-7-9-19-10-8-15;/h2-6,11-13,15,19H,7-10H2,1H3,(H,20,27);1H |
| InChIKey | VQDSUNNZOFRWRP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |