C22H16F2N2O4 — CID 1310709
N-[1,3-benzodioxol-5-yl-[(2-fluorobenzoyl)amino]methyl]-2-fluorobenzamide (PubChem CID 1310709) has the molecular formula C22H16F2N2O4 and a molecular weight of 410.38 g/mol. Its IUPAC name is N-[1,3-benzodioxol-5-yl-[(2-fluorobenzoyl)amino]methyl]-2-fluorobenzamide.
| Compound Name | N-[1,3-benzodioxol-5-yl-[(2-fluorobenzoyl)amino]methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 1310709 |
| Molecular Formula | C22H16F2N2O4 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[1,3-benzodioxol-5-yl-[(2-fluorobenzoyl)amino]methyl]-2-fluorobenzamide |
| SMILES | O=C(NC(NC(=O)c1ccccc1F)c1ccc2c(c1)OCO2)c1ccccc1F |
| InChI | InChI=1S/C22H16F2N2O4/c23-16-7-3-1-5-14(16)21(27)25-20(13-9-10-18-19(11-13)30-12-29-18)26-22(28)15-6-2-4-8-17(15)24/h1-11,20H,12H2,(H,25,27)(H,26,28) |
| InChIKey | VDIRNVPAKCHHSN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|