C19H14FN3O3 — CID 113036145
N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-2-fluorobenzamide (PubChem CID 113036145) has the molecular formula C19H14FN3O3 and a molecular weight of 351.34 g/mol. Its IUPAC name is N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-2-fluorobenzamide.
| Compound Name | N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 113036145 |
| Molecular Formula | C19H14FN3O3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(Nc2ccc3c(c2)OCO3)cn1)c1ccccc1F |
| InChI | InChI=1S/C19H14FN3O3/c20-15-4-2-1-3-14(15)19(24)23-18-8-6-13(10-21-18)22-12-5-7-16-17(9-12)26-11-25-16/h1-10,22H,11H2,(H,21,23,24) |
| InChIKey | DFZVLXRMKDAGEO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |