C20H17N3O4 — CID 113036150
N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-4-methoxybenzamide (PubChem CID 113036150) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-4-methoxybenzamide.
| Compound Name | N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 113036150 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Nc3ccc4c(c3)OCO4)cn2)cc1 |
| InChI | InChI=1S/C20H17N3O4/c1-25-16-6-2-13(3-7-16)20(24)23-19-9-5-15(11-21-19)22-14-4-8-17-18(10-14)27-12-26-17/h2-11,22H,12H2,1H3,(H,21,23,24) |
| InChIKey | YUFTVBCOHVGHSA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |