C18H15N3O3S — CID 113036157
N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-2-thiophen-2-ylacetamide (PubChem CID 113036157) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113036157 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[5-(1,3-benzodioxol-5-ylamino)-2-pyridinyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(Nc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C18H15N3O3S/c22-18(9-14-2-1-7-25-14)21-17-6-4-13(10-19-17)20-12-3-5-15-16(8-12)24-11-23-15/h1-8,10,20H,9,11H2,(H,19,21,22) |
| InChIKey | MGZVPUNSJAUTHH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |