C20H21N3OS — CID 113032823
2-thiophen-2-yl-N-[5-(2,4,6-trimethylanilino)-2-pyridinyl]acetamide (PubChem CID 113032823) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-[5-(2,4,6-trimethylanilino)-2-pyridinyl]acetamide.
| Compound Name | 2-thiophen-2-yl-N-[5-(2,4,6-trimethylanilino)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 113032823 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-thiophen-2-yl-N-[5-(2,4,6-trimethylanilino)-2-pyridinyl]acetamide |
| SMILES | Cc1cc(C)c(Nc2ccc(NC(=O)Cc3cccs3)nc2)c(C)c1 |
| InChI | InChI=1S/C20H21N3OS/c1-13-9-14(2)20(15(3)10-13)22-16-6-7-18(21-12-16)23-19(24)11-17-5-4-8-25-17/h4-10,12,22H,11H2,1-3H3,(H,21,23,24) |
| InChIKey | NNFCNVUYNYLDNY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |