C15H13Cl2NO3 — CID 60901147
1-(1,3-benzodioxol-5-yl)-2-(2,3-dichloroanilino)ethanol (PubChem CID 60901147) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(2,3-dichloroanilino)ethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(2,3-dichloroanilino)ethanol |
|---|---|
| PubChem CID | 60901147 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(2,3-dichloroanilino)ethanol |
| SMILES | OC(CNc1cccc(Cl)c1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13Cl2NO3/c16-10-2-1-3-11(15(10)17)18-7-12(19)9-4-5-13-14(6-9)21-8-20-13/h1-6,12,18-19H,7-8H2 |
| InChIKey | VLDLJNHNKJGWEL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |