C14H12Cl3NO — CID 60900575
1-(2-chlorophenyl)-2-(2,3-dichloroanilino)ethanol (PubChem CID 60900575) has the molecular formula C14H12Cl3NO and a molecular weight of 316.62 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-(2,3-dichloroanilino)ethanol.
| Compound Name | 1-(2-chlorophenyl)-2-(2,3-dichloroanilino)ethanol |
|---|---|
| PubChem CID | 60900575 |
| Molecular Formula | C14H12Cl3NO |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 1-(2-chlorophenyl)-2-(2,3-dichloroanilino)ethanol |
| SMILES | OC(CNc1cccc(Cl)c1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C14H12Cl3NO/c15-10-5-2-1-4-9(10)13(19)8-18-12-7-3-6-11(16)14(12)17/h1-7,13,18-19H,8H2 |
| InChIKey | RYBVSRLDYNCAAG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |