C15H13ClINO3 — CID 107606301
1-(1,3-benzodioxol-5-yl)-2-(2-chloro-4-iodoanilino)ethanol (PubChem CID 107606301) has the molecular formula C15H13ClINO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(2-chloro-4-iodoanilino)ethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(2-chloro-4-iodoanilino)ethanol |
|---|---|
| PubChem CID | 107606301 |
| Molecular Formula | C15H13ClINO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(2-chloro-4-iodoanilino)ethanol |
| SMILES | OC(CNc1ccc(I)cc1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13ClINO3/c16-11-6-10(17)2-3-12(11)18-7-13(19)9-1-4-14-15(5-9)21-8-20-14/h1-6,13,18-19H,7-8H2 |
| InChIKey | IMKJKSBRAJPALK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|