C11H11BrClF3O — CID 65432991
1-bromo-5-(1-chloro-3,3,3-trifluoropropyl)-4-methoxy-2-methylbenzene (PubChem CID 65432991) has the molecular formula C11H11BrClF3O and a molecular weight of 331.56 g/mol. Its IUPAC name is 1-bromo-5-(1-chloro-3,3,3-trifluoropropyl)-4-methoxy-2-methylbenzene.
| Compound Name | 1-bromo-5-(1-chloro-3,3,3-trifluoropropyl)-4-methoxy-2-methylbenzene |
|---|---|
| PubChem CID | 65432991 |
| Molecular Formula | C11H11BrClF3O |
| Molecular Weight | 331.56 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 1-bromo-5-(1-chloro-3,3,3-trifluoropropyl)-4-methoxy-2-methylbenzene |
| SMILES | COc1cc(C)c(Br)cc1C(Cl)CC(F)(F)F |
| InChI | InChI=1S/C11H11BrClF3O/c1-6-3-10(17-2)7(4-8(6)12)9(13)5-11(14,15)16/h3-4,9H,5H2,1-2H3 |
| InChIKey | SVGVSXPXWNPJFN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|