C10H10BrF3O2 — CID 65433362
1-(5-bromo-2-methoxy-4-methylphenyl)-2,2,2-trifluoroethanol (PubChem CID 65433362) has the molecular formula C10H10BrF3O2 and a molecular weight of 299.09 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxy-4-methylphenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(5-bromo-2-methoxy-4-methylphenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 65433362 |
| Molecular Formula | C10H10BrF3O2 |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 1-(5-bromo-2-methoxy-4-methylphenyl)-2,2,2-trifluoroethanol |
| SMILES | COc1cc(C)c(Br)cc1C(O)C(F)(F)F |
| InChI | InChI=1S/C10H10BrF3O2/c1-5-3-8(16-2)6(4-7(5)11)9(15)10(12,13)14/h3-4,9,15H,1-2H3 |
| InChIKey | RHWKKRKOHVQQLV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |